"""AutoPOE2 - Advanced Item Tooltip Tier & Mod Evaluator (Doc 29 / Doc 68). ============================================================================= Động cơ thẩm định trang bị và vật phẩm dựa trên phân tích Tooltip (OCR & Text): - Tiếp nhận ảnh chụp Tooltip trang bị hiếm thật từ thực địa (captures/*.png) hoặc text. - Nhận diện các dòng thuộc tính giá trị cao (Tier 1 Life/ES, +Skill Gems, High Elemental Resistances, Critical Multiplier, High Physical/Elemental DPS). - Tính toán điểm số hiệp đồng thuộc tính (Stat Synergy Score) và Pseudo Resistances. - Xuất đánh giá phân loại quyết định: + KEEP: Giữ lại trên người / Món đồ giá trị cực cao (God Roll / 3+ T1 / +Gems). + STASH: Cất vào Hòm đồ để trao đổi hoặc chế đồ (2+ T1/T2, đồ có giá trị giao dịch). + VENDOR: Bán cho NPC lấy vàng / đồ rác thuộc tính thấp hoặc không có hiệp đồng. Tuân thủ nghiêm ngặt: - Rule 1: Python 3.11 Cold Path Tier 2. - Rule 4: Module hóa độc lập trần file < 500 dòng. - Rule 16: Google Docstrings chuẩn mực. """ from __future__ import annotations from dataclasses import dataclass, field import os import re from typing import Any, Dict, List, Optional, Tuple, Union import numpy as np try: from PIL import Image except ImportError: Image = None # type: ignore[assignment] try: import winocr except ImportError: winocr = None from src.assistant_tool.pickit.mod_tier_patterns import ( EvaluatedMod, ItemEvaluationAction, ModCategory, classify_single_mod_line, ) @dataclass class ItemEvaluationReport: """Báo cáo đánh giá toàn diện giá trị và phân loại vật phẩm.""" item_name: str = "" item_class: str = "" rarity: str = "NORMAL" item_level: int = 0 action: ItemEvaluationAction = ItemEvaluationAction.VENDOR total_score: float = 0.0 tier_1_count: int = 0 tier_2_count: int = 0 high_value_mods: List[EvaluatedMod] = field(default_factory=list) all_mods: List[EvaluatedMod] = field(default_factory=list) reasons: List[str] = field(default_factory=list) pseudo_resists: Dict[str, float] = field(default_factory=dict) synergy_bonuses: List[str] = field(default_factory=list) raw_text: str = "" class ItemTooltipEvaluator: """Động cơ bóc tách và định giá Tooltip trang bị theo chuẩn Tier & Mod POE2.""" # Ngưỡng phân loại hành động KEEP_SCORE_THRESHOLD: float = 70.0 STASH_SCORE_THRESHOLD: float = 40.0 def __init__( self, keep_score_threshold: float = 70.0, stash_score_threshold: float = 40.0, ) -> None: """Khởi tạo ItemTooltipEvaluator. Args: keep_score_threshold: Ngưỡng điểm tối thiểu để phân loại KEEP. stash_score_threshold: Ngưỡng điểm tối thiểu để phân loại STASH. """ self.keep_score_threshold = keep_score_threshold self.stash_score_threshold = stash_score_threshold def evaluate_text(self, text_blob: str) -> ItemEvaluationReport: """Đánh giá vật phẩm từ chuỗi văn bản Tooltip (Clipboard hoặc OCR). Args: text_blob: Chuỗi văn bản đầy đủ của tooltip vật phẩm. Returns: ItemEvaluationReport chứa kết quả phân loại và chi tiết mod. """ if not text_blob or not text_blob.strip(): return ItemEvaluationReport(action=ItemEvaluationAction.VENDOR, reasons=["Empty tooltip text"]) lines = [line.strip() for line in text_blob.strip().splitlines() if line.strip()] # 1. Trích xuất thông tin Header item_class = "" rarity = "NORMAL" item_name = "" item_level = 0 header_lines_processed = 0 for i, line in enumerate(lines): if line.startswith("Item Class:"): item_class = line.split(":", 1)[1].strip() header_lines_processed = max(header_lines_processed, i + 1) elif line.startswith("Rarity:"): rarity = line.split(":", 1)[1].strip().upper() if i + 1 < len(lines) and not lines[i + 1].startswith("---"): item_name = lines[i + 1].strip() header_lines_processed = max(header_lines_processed, i + 2) elif line.startswith("Item Level:"): m = re.search(r"Item\s+Level:\s*(\d+)", line, re.IGNORECASE) if m: item_level = int(m.group(1)) # Fallback tìm item level nếu text OCR dạng iLvI: 80 hoặc iLvl: 80 if item_level == 0: m_ilvl = re.search(r"iLv[lI]:?\s*(\d+)", text_blob, re.IGNORECASE) if m_ilvl: item_level = int(m_ilvl.group(1)) # 2. Bóc tách và phân loại các dòng mod evaluated_mods: List[EvaluatedMod] = [] skip_prefixes = ( "--------", "Item Class", "Rarity", "Requirements", "Level:", "Str:", "Dex:", "Int:", "Sockets:", "Item Level:", "Corrupted", "Can be used in a Map Device" ) for line in lines: # Loại bỏ các tag phân loại advance modifier dạng { Prefix Modifier ... } clean_line = re.sub(r"\{[^}]*\}", "", line).strip() # Loại bỏ icon bullet rác nếu OCR nhận nhầm clean_line = clean_line.lstrip("•-* ") if not clean_line: continue if any(clean_line.startswith(p) for p in skip_prefixes): continue if clean_line == item_name: continue mod_eval = classify_single_mod_line(clean_line) if mod_eval is not None: evaluated_mods.append(mod_eval) # 3. Tính toán Pseudo Resistances & Thống kê fire_res = 0.0 cold_res = 0.0 light_res = 0.0 chaos_res = 0.0 total_ele_res = 0.0 has_skill_gems = False max_life_val = 0.0 has_move_speed_t1 = False tier_1_count = 0 tier_2_count = 0 base_score = 0.0 high_value_mods: List[EvaluatedMod] = [] for m_eval in evaluated_mods: base_score += m_eval.score if m_eval.is_tier_1: tier_1_count += 1 high_value_mods.append(m_eval) elif m_eval.tier_estimate == 2: tier_2_count += 1 high_value_mods.append(m_eval) # Thu thập chỉ số thống kê if m_eval.category == ModCategory.RESISTANCE: if "Fire" in m_eval.name: fire_res += m_eval.value elif "Cold" in m_eval.name: cold_res += m_eval.value elif "Lightning" in m_eval.name: light_res += m_eval.value elif "Chaos" in m_eval.name: chaos_res += m_eval.value elif "All Elemental" in m_eval.name: total_ele_res += m_eval.value elif m_eval.category == ModCategory.SKILL_GEMS: has_skill_gems = True elif m_eval.category == ModCategory.LIFE: max_life_val = max(max_life_val, m_eval.value) elif m_eval.category == ModCategory.MOVE_SPEED and m_eval.is_tier_1: has_move_speed_t1 = True total_ele_res += (fire_res + cold_res + light_res) pseudo_res = { "fire": fire_res, "cold": cold_res, "lightning": light_res, "chaos": chaos_res, "total_ele": total_ele_res, "total_all": total_ele_res + chaos_res, } # 4. Hiệp đồng thuộc tính (Stat Synergy Bonuses) synergy_bonuses: List[str] = [] synergy_score = 0.0 # Hiệp đồng 1: Máu cao + Đa Kháng if max_life_val >= 70.0 and total_ele_res >= 60.0: synergy_score += 20.0 synergy_bonuses.append("Life + Multi Resistance Synergy (+20 pts)") # Hiệp đồng 2: Ba dòng Kháng Nguyên Tố cực cao if total_ele_res >= 80.0: synergy_score += 15.0 synergy_bonuses.append(f"High Pseudo Elemental Resistance ({int(total_ele_res)}%) (+15 pts)") # Hiệp đồng 3: +Skill Gems kết hợp if has_skill_gems: synergy_score += 20.0 synergy_bonuses.append("High-Value +Skill Gems Anchor (+20 pts)") # Hiệp đồng 4: Giày Tốc Độ Chạy + Máu / Kháng if has_move_speed_t1 and (max_life_val >= 50.0 or total_ele_res >= 30.0): synergy_score += 20.0 synergy_bonuses.append("Boots Movement Speed + Survival Synergy (+20 pts)") # Hiệp đồng 5: Kháng Hỗn Loạn cao kết hợp Kháng Nguyên Tố if chaos_res >= 20.0 and total_ele_res >= 40.0: synergy_score += 15.0 synergy_bonuses.append("Chaos & Elemental Survival Synergy (+15 pts)") total_score = max(0.0, base_score + synergy_score) # 5. Quyết định Phân Loại (KEEP / STASH / VENDOR) reasons: List[str] = [] action = ItemEvaluationAction.VENDOR # Kiểm tra điều kiện KEEP (God Roll / 3+ T1 / +Gems) if ( total_score >= self.keep_score_threshold or tier_1_count >= 3 or (has_skill_gems and total_score >= 50.0) or (max_life_val >= 100.0 and total_ele_res >= 80.0) or (has_move_speed_t1 and max_life_val >= 80.0 and total_ele_res >= 60.0) ): action = ItemEvaluationAction.KEEP if tier_1_count >= 3: reasons.append(f"God-roll gear with {tier_1_count} Tier 1 affixes") if has_skill_gems: reasons.append("+Skill Gems with strong supporting stats") if total_score >= self.keep_score_threshold: reasons.append(f"Outstanding total score: {total_score:.1f}") # Kiểm tra điều kiện STASH (Đồ tốt bán sàn / 2 T1 / 1 T1 + T2) elif ( total_score >= self.stash_score_threshold or tier_1_count >= 2 or (tier_1_count >= 1 and tier_2_count >= 1) or (max_life_val >= 70.0 and total_ele_res >= 40.0) or (chaos_res >= 25.0) or has_move_speed_t1 ): action = ItemEvaluationAction.STASH if tier_1_count >= 2: reasons.append(f"Tradeable gear with {tier_1_count} Tier 1 affixes") elif has_move_speed_t1: reasons.append("High tier Movement Speed boots") elif chaos_res >= 25.0: reasons.append(f"High Chaos Resistance ({int(chaos_res)}%)") else: reasons.append(f"Valuable stats total score: {total_score:.1f}") # Mặc định VENDOR else: action = ItemEvaluationAction.VENDOR reasons.append(f"Low utility or vendor filler (Score: {total_score:.1f}, T1: {tier_1_count})") return ItemEvaluationReport( item_name=item_name or "Unknown Item", item_class=item_class, rarity=rarity, item_level=item_level, action=action, total_score=total_score, tier_1_count=tier_1_count, tier_2_count=tier_2_count, high_value_mods=high_value_mods, all_mods=evaluated_mods, reasons=reasons, pseudo_resists=pseudo_res, synergy_bonuses=synergy_bonuses, raw_text=text_blob, ) def evaluate_image( self, img_input: Union[str, Image.Image, np.ndarray], ) -> ItemEvaluationReport: """Đánh giá vật phẩm từ ảnh chụp Tooltip hoặc toàn màn hình thông qua OCR. Args: img_input: Đường dẫn ảnh, đối tượng PIL Image, hoặc numpy array. Returns: ItemEvaluationReport được bóc tách từ ảnh. """ pil_img: Optional[Image.Image] = None if isinstance(img_input, str): if os.path.exists(img_input) and Image is not None: pil_img = Image.open(img_input).convert("RGB") elif isinstance(img_input, np.ndarray) and Image is not None: pil_img = Image.fromarray(img_input).convert("RGB") elif Image is not None and isinstance(img_input, Image.Image): pil_img = img_input.convert("RGB") if pil_img is None: return ItemEvaluationReport(action=ItemEvaluationAction.VENDOR, reasons=["Invalid image input"]) # Sử dụng winocr trích xuất toàn bộ văn bản text_lines: List[str] = [] if winocr is not None: try: ocr_result = winocr.recognize_pil_sync(pil_img) for line in ocr_result.get("lines", []): txt = line.get("text", "").strip() if txt: text_lines.append(txt) except Exception as e: return ItemEvaluationReport( action=ItemEvaluationAction.VENDOR, reasons=[f"OCR recognition error: {e}"], ) full_text = "\n".join(text_lines) return self.evaluate_text(full_text)